C14H14N2O3 — CID 8543923
[2-(2-methylanilino)-2-oxoethyl] 1H-pyrrole-2-carboxylate (PubChem CID 8543923) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is [2-(2-methylanilino)-2-oxoethyl] 1H-pyrrole-2-carboxylate.
| Compound Name | [2-(2-methylanilino)-2-oxoethyl] 1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 8543923 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | [2-(2-methylanilino)-2-oxoethyl] 1H-pyrrole-2-carboxylate |
| SMILES | Cc1ccccc1NC(=O)COC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C14H14N2O3/c1-10-5-2-3-6-11(10)16-13(17)9-19-14(18)12-7-4-8-15-12/h2-8,15H,9H2,1H3,(H,16,17) |
| InChIKey | VXABCJJWXRDRMB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |