C13H10ClFN2O3 — CID 8544807
[2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 1H-pyrrole-2-carboxylate (PubChem CID 8544807) has the molecular formula C13H10ClFN2O3 and a molecular weight of 296.69 g/mol. Its IUPAC name is [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 1H-pyrrole-2-carboxylate.
| Compound Name | [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 8544807 |
| Molecular Formula | C13H10ClFN2O3 |
| Molecular Weight | 296.69 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 1H-pyrrole-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc[nH]1)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C13H10ClFN2O3/c14-8-3-4-10(9(15)6-8)17-12(18)7-20-13(19)11-2-1-5-16-11/h1-6,16H,7H2,(H,17,18) |
| InChIKey | UNUFNWHEIVCZEJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.69 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |