C15H9Cl2F2NO3 — CID 71823562
[2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 2-chloro-5-fluorobenzoate (PubChem CID 71823562) has the molecular formula C15H9Cl2F2NO3 and a molecular weight of 360.14 g/mol. Its IUPAC name is [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 2-chloro-5-fluorobenzoate.
| Compound Name | [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 2-chloro-5-fluorobenzoate |
|---|---|
| PubChem CID | 71823562 |
| Molecular Formula | C15H9Cl2F2NO3 |
| Molecular Weight | 360.14 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 2-chloro-5-fluorobenzoate |
| SMILES | O=C(COC(=O)c1cc(F)ccc1Cl)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C15H9Cl2F2NO3/c16-8-1-4-13(12(19)5-8)20-14(21)7-23-15(22)10-6-9(18)2-3-11(10)17/h1-6H,7H2,(H,20,21) |
| InChIKey | PTPJDZRWWLSJEU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.14 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |