C15H10Cl2FNO4 — CID 8604243
[2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 5-chloro-2-hydroxybenzoate (PubChem CID 8604243) has the molecular formula C15H10Cl2FNO4 and a molecular weight of 358.15 g/mol. Its IUPAC name is [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 5-chloro-2-hydroxybenzoate.
| Compound Name | [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 5-chloro-2-hydroxybenzoate |
|---|---|
| PubChem CID | 8604243 |
| Molecular Formula | C15H10Cl2FNO4 |
| Molecular Weight | 358.15 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 5-chloro-2-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1cc(Cl)ccc1O)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C15H10Cl2FNO4/c16-8-1-4-13(20)10(5-8)15(22)23-7-14(21)19-12-3-2-9(18)6-11(12)17/h1-6,20H,7H2,(H,19,21) |
| InChIKey | SRBVCKXVRHBVLP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.15 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |