C16H10Cl2F3NO4 — CID 8850644
[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 5-chloro-2-hydroxybenzoate (PubChem CID 8850644) has the molecular formula C16H10Cl2F3NO4 and a molecular weight of 408.16 g/mol. Its IUPAC name is [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 5-chloro-2-hydroxybenzoate.
| Compound Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 5-chloro-2-hydroxybenzoate |
|---|---|
| PubChem CID | 8850644 |
| Molecular Formula | C16H10Cl2F3NO4 |
| Molecular Weight | 408.16 g/mol |
| Exact Mass | 406.99 |
| IUPAC Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 5-chloro-2-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1cc(Cl)ccc1O)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C16H10Cl2F3NO4/c17-8-2-4-13(23)10(5-8)15(25)26-7-14(24)22-12-3-1-9(18)6-11(12)16(19,20)21/h1-6,23H,7H2,(H,22,24) |
| InChIKey | LGFMAFXRQWASNS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.16 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |