C15H10ClF3N2O4 — CID 9114937
[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 1-oxidopyridin-1-ium-4-carboxylate (PubChem CID 9114937) has the molecular formula C15H10ClF3N2O4 and a molecular weight of 374.70 g/mol. Its IUPAC name is [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 1-oxidopyridin-1-ium-4-carboxylate.
| Compound Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 1-oxidopyridin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 9114937 |
| Molecular Formula | C15H10ClF3N2O4 |
| Molecular Weight | 374.70 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 1-oxidopyridin-1-ium-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc[n+]([O-])cc1)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C15H10ClF3N2O4/c16-10-1-2-12(11(7-10)15(17,18)19)20-13(22)8-25-14(23)9-3-5-21(24)6-4-9/h1-7H,8H2,(H,20,22) |
| InChIKey | CJDAXLIYFILXSB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.70 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|