C20H20ClF3N2O3 — CID 55314076
[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 4-(diethylamino)benzoate (PubChem CID 55314076) has the molecular formula C20H20ClF3N2O3 and a molecular weight of 428.84 g/mol. Its IUPAC name is [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 4-(diethylamino)benzoate.
| Compound Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 4-(diethylamino)benzoate |
|---|---|
| PubChem CID | 55314076 |
| Molecular Formula | C20H20ClF3N2O3 |
| Molecular Weight | 428.84 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 4-(diethylamino)benzoate |
| SMILES | CCN(CC)c1ccc(C(=O)OCC(=O)Nc2ccc(Cl)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H20ClF3N2O3/c1-3-26(4-2)15-8-5-13(6-9-15)19(28)29-12-18(27)25-17-10-7-14(21)11-16(17)20(22,23)24/h5-11H,3-4,12H2,1-2H3,(H,25,27) |
| InChIKey | KDTDGVYMTQFWDG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.84 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |