C18H13Cl2F3N2O4 — CID 2397372
[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 2-[(4-chlorobenzoyl)amino]acetate (PubChem CID 2397372) has the molecular formula C18H13Cl2F3N2O4 and a molecular weight of 449.21 g/mol. Its IUPAC name is [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 2-[(4-chlorobenzoyl)amino]acetate.
| Compound Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 2-[(4-chlorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 2397372 |
| Molecular Formula | C18H13Cl2F3N2O4 |
| Molecular Weight | 449.21 g/mol |
| Exact Mass | 448.02 |
| IUPAC Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 2-[(4-chlorobenzoyl)amino]acetate |
| SMILES | O=C(COC(=O)CNC(=O)c1ccc(Cl)cc1)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C18H13Cl2F3N2O4/c19-11-3-1-10(2-4-11)17(28)24-8-16(27)29-9-15(26)25-14-6-5-12(20)7-13(14)18(21,22)23/h1-7H,8-9H2,(H,24,28)(H,25,26) |
| InChIKey | OUAGYBRPWPNELJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.21 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |