C24H18ClF3N2O4 — CID 55459883
[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 2-benzamido-2-phenylacetate (PubChem CID 55459883) has the molecular formula C24H18ClF3N2O4 and a molecular weight of 490.87 g/mol. Its IUPAC name is [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 2-benzamido-2-phenylacetate.
| Compound Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 2-benzamido-2-phenylacetate |
|---|---|
| PubChem CID | 55459883 |
| Molecular Formula | C24H18ClF3N2O4 |
| Molecular Weight | 490.87 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 2-benzamido-2-phenylacetate |
| SMILES | O=C(COC(=O)C(NC(=O)c1ccccc1)c1ccccc1)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C24H18ClF3N2O4/c25-17-11-12-19(18(13-17)24(26,27)28)29-20(31)14-34-23(33)21(15-7-3-1-4-8-15)30-22(32)16-9-5-2-6-10-16/h1-13,21H,14H2,(H,29,31)(H,30,32) |
| InChIKey | YZAGFKWCCVESIA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.87 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |