C15H6ClF8NO2 — CID 4512621
N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(2,3,4,5,6-pentafluorophenoxy)acetamide (PubChem CID 4512621) has the molecular formula C15H6ClF8NO2 and a molecular weight of 419.66 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(2,3,4,5,6-pentafluorophenoxy)acetamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(2,3,4,5,6-pentafluorophenoxy)acetamide |
|---|---|
| PubChem CID | 4512621 |
| Molecular Formula | C15H6ClF8NO2 |
| Molecular Weight | 419.66 g/mol |
| Exact Mass | 419.00 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(2,3,4,5,6-pentafluorophenoxy)acetamide |
| SMILES | O=C(COc1c(F)c(F)c(F)c(F)c1F)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C15H6ClF8NO2/c16-5-1-2-7(6(3-5)15(22,23)24)25-8(26)4-27-14-12(20)10(18)9(17)11(19)13(14)21/h1-3H,4H2,(H,25,26) |
| InChIKey | BVTNLCUNZYVERG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.66 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|