C16H12ClF3INO2 — CID 5111404
2-(4-chloro-2-methylphenoxy)-N-[4-iodo-2-(trifluoromethyl)phenyl]acetamide (PubChem CID 5111404) has the molecular formula C16H12ClF3INO2 and a molecular weight of 469.63 g/mol. Its IUPAC name is 2-(4-chloro-2-methylphenoxy)-N-[4-iodo-2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(4-chloro-2-methylphenoxy)-N-[4-iodo-2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 5111404 |
| Molecular Formula | C16H12ClF3INO2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 468.96 |
| IUPAC Name | 2-(4-chloro-2-methylphenoxy)-N-[4-iodo-2-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)Nc1ccc(I)cc1C(F)(F)F |
| InChI | InChI=1S/C16H12ClF3INO2/c1-9-6-10(17)2-5-14(9)24-8-15(23)22-13-4-3-11(21)7-12(13)16(18,19)20/h2-7H,8H2,1H3,(H,22,23) |
| InChIKey | LSCKXUAXEIGVAY-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|