C17H15F3INO2 — CID 1293662
2-(4-ethylphenoxy)-N-[4-iodo-2-(trifluoromethyl)phenyl]acetamide (PubChem CID 1293662) has the molecular formula C17H15F3INO2 and a molecular weight of 449.21 g/mol. Its IUPAC name is 2-(4-ethylphenoxy)-N-[4-iodo-2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(4-ethylphenoxy)-N-[4-iodo-2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 1293662 |
| Molecular Formula | C17H15F3INO2 |
| Molecular Weight | 449.21 g/mol |
| Exact Mass | 449.01 |
| IUPAC Name | 2-(4-ethylphenoxy)-N-[4-iodo-2-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCc1ccc(OCC(=O)Nc2ccc(I)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H15F3INO2/c1-2-11-3-6-13(7-4-11)24-10-16(23)22-15-8-5-12(21)9-14(15)17(18,19)20/h3-9H,2,10H2,1H3,(H,22,23) |
| InChIKey | OXHYBUBKBWKIKM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.21 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|