C16H10ClF5N2O2 — CID 108956825
N'-[4-chloro-2-(trifluoromethyl)phenyl]-N-(3,4-difluorophenyl)propanediamide (PubChem CID 108956825) has the molecular formula C16H10ClF5N2O2 and a molecular weight of 392.71 g/mol. Its IUPAC name is N'-[4-chloro-2-(trifluoromethyl)phenyl]-N-(3,4-difluorophenyl)propanediamide.
| Compound Name | N'-[4-chloro-2-(trifluoromethyl)phenyl]-N-(3,4-difluorophenyl)propanediamide |
|---|---|
| PubChem CID | 108956825 |
| Molecular Formula | C16H10ClF5N2O2 |
| Molecular Weight | 392.71 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | N'-[4-chloro-2-(trifluoromethyl)phenyl]-N-(3,4-difluorophenyl)propanediamide |
| SMILES | O=C(CC(=O)Nc1ccc(Cl)cc1C(F)(F)F)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H10ClF5N2O2/c17-8-1-4-13(10(5-8)16(20,21)22)24-15(26)7-14(25)23-9-2-3-11(18)12(19)6-9/h1-6H,7H2,(H,23,25)(H,24,26) |
| InChIKey | FSPAXLGWFMLGEK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.71 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|