C16H11ClF6N2O — CID 26437919
N-[4-chloro-2-(trifluoromethyl)phenyl]-2-[4-(trifluoromethyl)anilino]acetamide (PubChem CID 26437919) has the molecular formula C16H11ClF6N2O and a molecular weight of 396.72 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-2-[4-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-[4-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 26437919 |
| Molecular Formula | C16H11ClF6N2O |
| Molecular Weight | 396.72 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-[4-(trifluoromethyl)anilino]acetamide |
| SMILES | O=C(CNc1ccc(C(F)(F)F)cc1)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C16H11ClF6N2O/c17-10-3-6-13(12(7-10)16(21,22)23)25-14(26)8-24-11-4-1-9(2-5-11)15(18,19)20/h1-7,24H,8H2,(H,25,26) |
| InChIKey | XMKJTZNMROBLSB-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.72 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |