C17H13F6N3O2 — CID 46633419
N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2-[4-(trifluoromethyl)anilino]acetamide (PubChem CID 46633419) has the molecular formula C17H13F6N3O2 and a molecular weight of 405.30 g/mol. Its IUPAC name is N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2-[4-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2-[4-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 46633419 |
| Molecular Formula | C17H13F6N3O2 |
| Molecular Weight | 405.30 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2-[4-(trifluoromethyl)anilino]acetamide |
| SMILES | O=C(CNc1ccc(C(F)(F)F)cc1)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H13F6N3O2/c18-11-5-6-12(16(20)15(11)19)26-14(28)8-25-13(27)7-24-10-3-1-9(2-4-10)17(21,22)23/h1-6,24H,7-8H2,(H,25,27)(H,26,28) |
| InChIKey | NWJXMPXRMKOFHE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|