C17H13F6N3O2 — CID 41474710
2-[[3-(trifluoromethyl)phenyl]methylcarbamoylamino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 41474710) has the molecular formula C17H13F6N3O2 and a molecular weight of 405.30 g/mol. Its IUPAC name is 2-[[3-(trifluoromethyl)phenyl]methylcarbamoylamino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[3-(trifluoromethyl)phenyl]methylcarbamoylamino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 41474710 |
| Molecular Formula | C17H13F6N3O2 |
| Molecular Weight | 405.30 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 2-[[3-(trifluoromethyl)phenyl]methylcarbamoylamino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CNC(=O)NCc1cccc(C(F)(F)F)c1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H13F6N3O2/c18-11-4-5-12(15(20)14(11)19)26-13(27)8-25-16(28)24-7-9-2-1-3-10(6-9)17(21,22)23/h1-6H,7-8H2,(H,26,27)(H2,24,25,28) |
| InChIKey | FJVLGMXAUQDLRW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|