C18H15F6N3O2 — CID 46494014
2-[2-[4-(trifluoromethyl)phenyl]ethylcarbamoylamino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 46494014) has the molecular formula C18H15F6N3O2 and a molecular weight of 419.33 g/mol. Its IUPAC name is 2-[2-[4-(trifluoromethyl)phenyl]ethylcarbamoylamino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[2-[4-(trifluoromethyl)phenyl]ethylcarbamoylamino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 46494014 |
| Molecular Formula | C18H15F6N3O2 |
| Molecular Weight | 419.33 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 2-[2-[4-(trifluoromethyl)phenyl]ethylcarbamoylamino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CNC(=O)NCCc1ccc(C(F)(F)F)cc1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H15F6N3O2/c19-12-5-6-13(16(21)15(12)20)27-14(28)9-26-17(29)25-8-7-10-1-3-11(4-2-10)18(22,23)24/h1-6H,7-9H2,(H,27,28)(H2,25,26,29) |
| InChIKey | GAZGABNCVONRAA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|