C18H11F9N2O3 — CID 4839539
2-[[2-[3,5-bis(trifluoromethyl)phenoxy]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 4839539) has the molecular formula C18H11F9N2O3 and a molecular weight of 474.28 g/mol. Its IUPAC name is 2-[[2-[3,5-bis(trifluoromethyl)phenoxy]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[2-[3,5-bis(trifluoromethyl)phenoxy]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 4839539 |
| Molecular Formula | C18H11F9N2O3 |
| Molecular Weight | 474.28 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | 2-[[2-[3,5-bis(trifluoromethyl)phenoxy]acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(COc1cc(C(F)(F)F)cc(C(F)(F)F)c1)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H11F9N2O3/c19-11-1-2-12(16(21)15(11)20)29-13(30)6-28-14(31)7-32-10-4-8(17(22,23)24)3-9(5-10)18(25,26)27/h1-5H,6-7H2,(H,28,31)(H,29,30) |
| InChIKey | RQELPEFEWZZQJN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.28 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|