C20H21F3N2O3 — CID 7535879
2-[[2-(3-methyl-4-propan-2-ylphenoxy)acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 7535879) has the molecular formula C20H21F3N2O3 and a molecular weight of 394.39 g/mol. Its IUPAC name is 2-[[2-(3-methyl-4-propan-2-ylphenoxy)acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[2-(3-methyl-4-propan-2-ylphenoxy)acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 7535879 |
| Molecular Formula | C20H21F3N2O3 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 2-[[2-(3-methyl-4-propan-2-ylphenoxy)acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | Cc1cc(OCC(=O)NCC(=O)Nc2ccc(F)c(F)c2F)ccc1C(C)C |
| InChI | InChI=1S/C20H21F3N2O3/c1-11(2)14-5-4-13(8-12(14)3)28-10-18(27)24-9-17(26)25-16-7-6-15(21)19(22)20(16)23/h4-8,11H,9-10H2,1-3H3,(H,24,27)(H,25,26) |
| InChIKey | RZFYITNTGDBNOT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|