C16H12ClF3N2O3 — CID 7601440
2-[[2-(3-chlorophenoxy)acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 7601440) has the molecular formula C16H12ClF3N2O3 and a molecular weight of 372.73 g/mol. Its IUPAC name is 2-[[2-(3-chlorophenoxy)acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[2-(3-chlorophenoxy)acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 7601440 |
| Molecular Formula | C16H12ClF3N2O3 |
| Molecular Weight | 372.73 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 2-[[2-(3-chlorophenoxy)acetyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(COc1cccc(Cl)c1)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H12ClF3N2O3/c17-9-2-1-3-10(6-9)25-8-14(24)21-7-13(23)22-12-5-4-11(18)15(19)16(12)20/h1-6H,7-8H2,(H,21,24)(H,22,23) |
| InChIKey | RHDOIARLQVPAKY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.73 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|