C23H22ClF3N2O4 — CID 46531351
[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] 1-(3-chlorophenyl)cyclohexane-1-carboxylate (PubChem CID 46531351) has the molecular formula C23H22ClF3N2O4 and a molecular weight of 482.89 g/mol. Its IUPAC name is [2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] 1-(3-chlorophenyl)cyclohexane-1-carboxylate.
| Compound Name | [2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] 1-(3-chlorophenyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 46531351 |
| Molecular Formula | C23H22ClF3N2O4 |
| Molecular Weight | 482.89 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | [2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] 1-(3-chlorophenyl)cyclohexane-1-carboxylate |
| SMILES | O=C(COC(=O)C1(c2cccc(Cl)c2)CCCCC1)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C23H22ClF3N2O4/c24-15-6-4-5-14(11-15)23(9-2-1-3-10-23)22(32)33-13-19(31)28-12-18(30)29-17-8-7-16(25)20(26)21(17)27/h4-8,11H,1-3,9-10,12-13H2,(H,28,31)(H,29,30) |
| InChIKey | XQKNCQXRVVOTIU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.89 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|