C22H23FN2O4 — CID 8611557
[2-[[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 1-phenylcyclopentane-1-carboxylate (PubChem CID 8611557) has the molecular formula C22H23FN2O4 and a molecular weight of 398.43 g/mol. Its IUPAC name is [2-[[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 1-phenylcyclopentane-1-carboxylate.
| Compound Name | [2-[[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 1-phenylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 8611557 |
| Molecular Formula | C22H23FN2O4 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | [2-[[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 1-phenylcyclopentane-1-carboxylate |
| SMILES | O=C(COC(=O)C1(c2ccccc2)CCCC1)NCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C22H23FN2O4/c23-17-8-10-18(11-9-17)25-19(26)14-24-20(27)15-29-21(28)22(12-4-5-13-22)16-6-2-1-3-7-16/h1-3,6-11H,4-5,12-15H2,(H,24,27)(H,25,26) |
| InChIKey | ZQBVKCKWBVXHHE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |