C20H15F6NO3 — CID 2355135
[2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 1-(4-fluorophenyl)cyclopentane-1-carboxylate (PubChem CID 2355135) has the molecular formula C20H15F6NO3 and a molecular weight of 431.33 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 1-(4-fluorophenyl)cyclopentane-1-carboxylate.
| Compound Name | [2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 1-(4-fluorophenyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 2355135 |
| Molecular Formula | C20H15F6NO3 |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | [2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 1-(4-fluorophenyl)cyclopentane-1-carboxylate |
| SMILES | O=C(COC(=O)C1(c2ccc(F)cc2)CCCC1)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H15F6NO3/c21-11-5-3-10(4-6-11)20(7-1-2-8-20)19(29)30-9-12(28)27-18-16(25)14(23)13(22)15(24)17(18)26/h3-6H,1-2,7-9H2,(H,27,28) |
| InChIKey | GGEWFCICTXVZCY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|