C20H20FNO3 — CID 7866420
(2-anilino-2-oxoethyl) 1-(4-fluorophenyl)cyclopentane-1-carboxylate (PubChem CID 7866420) has the molecular formula C20H20FNO3 and a molecular weight of 341.38 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 1-(4-fluorophenyl)cyclopentane-1-carboxylate.
| Compound Name | (2-anilino-2-oxoethyl) 1-(4-fluorophenyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 7866420 |
| Molecular Formula | C20H20FNO3 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (2-anilino-2-oxoethyl) 1-(4-fluorophenyl)cyclopentane-1-carboxylate |
| SMILES | O=C(COC(=O)C1(c2ccc(F)cc2)CCCC1)Nc1ccccc1 |
| InChI | InChI=1S/C20H20FNO3/c21-16-10-8-15(9-11-16)20(12-4-5-13-20)19(24)25-14-18(23)22-17-6-2-1-3-7-17/h1-3,6-11H,4-5,12-14H2,(H,22,23) |
| InChIKey | BEGQJPHDAUBPDQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |