C24H28FNO3 — CID 2422072
[2-(4-tert-butylanilino)-2-oxoethyl] 1-(4-fluorophenyl)cyclopentane-1-carboxylate (PubChem CID 2422072) has the molecular formula C24H28FNO3 and a molecular weight of 397.49 g/mol. Its IUPAC name is [2-(4-tert-butylanilino)-2-oxoethyl] 1-(4-fluorophenyl)cyclopentane-1-carboxylate.
| Compound Name | [2-(4-tert-butylanilino)-2-oxoethyl] 1-(4-fluorophenyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 2422072 |
| Molecular Formula | C24H28FNO3 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | [2-(4-tert-butylanilino)-2-oxoethyl] 1-(4-fluorophenyl)cyclopentane-1-carboxylate |
| SMILES | CC(C)(C)c1ccc(NC(=O)COC(=O)C2(c3ccc(F)cc3)CCCC2)cc1 |
| InChI | InChI=1S/C24H28FNO3/c1-23(2,3)17-8-12-20(13-9-17)26-21(27)16-29-22(28)24(14-4-5-15-24)18-6-10-19(25)11-7-18/h6-13H,4-5,14-16H2,1-3H3,(H,26,27) |
| InChIKey | LXGIVVONYPCIAX-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |