C16H20N2O4 — CID 8807699
[2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl] 1-phenylcyclopentane-1-carboxylate (PubChem CID 8807699) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is [2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl] 1-phenylcyclopentane-1-carboxylate.
| Compound Name | [2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl] 1-phenylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 8807699 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | [2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl] 1-phenylcyclopentane-1-carboxylate |
| SMILES | NC(=O)CNC(=O)COC(=O)C1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C16H20N2O4/c17-13(19)10-18-14(20)11-22-15(21)16(8-4-5-9-16)12-6-2-1-3-7-12/h1-3,6-7H,4-5,8-11H2,(H2,17,19)(H,18,20) |
| InChIKey | CYTAEHZQICLALA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |