C21H21FN2O4 — CID 8610838
[2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 1-phenylcyclopentane-1-carboxylate (PubChem CID 8610838) has the molecular formula C21H21FN2O4 and a molecular weight of 384.41 g/mol. Its IUPAC name is [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 1-phenylcyclopentane-1-carboxylate.
| Compound Name | [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 1-phenylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 8610838 |
| Molecular Formula | C21H21FN2O4 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] 1-phenylcyclopentane-1-carboxylate |
| SMILES | O=C(COC(=O)C1(c2ccccc2)CCCC1)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C21H21FN2O4/c22-17-11-5-4-10-16(17)19(26)24-23-18(25)14-28-20(27)21(12-6-7-13-21)15-8-2-1-3-9-15/h1-5,8-11H,6-7,12-14H2,(H,23,25)(H,24,26) |
| InChIKey | CNXZZESMBKDNQS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|