C24H29NO3 — CID 8611306
[2-(2,6-diethylanilino)-2-oxoethyl] 1-phenylcyclopentane-1-carboxylate (PubChem CID 8611306) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is [2-(2,6-diethylanilino)-2-oxoethyl] 1-phenylcyclopentane-1-carboxylate.
| Compound Name | [2-(2,6-diethylanilino)-2-oxoethyl] 1-phenylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 8611306 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | [2-(2,6-diethylanilino)-2-oxoethyl] 1-phenylcyclopentane-1-carboxylate |
| SMILES | CCc1cccc(CC)c1NC(=O)COC(=O)C1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C24H29NO3/c1-3-18-11-10-12-19(4-2)22(18)25-21(26)17-28-23(27)24(15-8-9-16-24)20-13-6-5-7-14-20/h5-7,10-14H,3-4,8-9,15-17H2,1-2H3,(H,25,26) |
| InChIKey | KNPBABCXZNDCKY-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |