C18H13ClF3NO3 — CID 8589539
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 1-(4-chlorophenyl)cyclopropane-1-carboxylate (PubChem CID 8589539) has the molecular formula C18H13ClF3NO3 and a molecular weight of 383.75 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 1-(4-chlorophenyl)cyclopropane-1-carboxylate.
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 1-(4-chlorophenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 8589539 |
| Molecular Formula | C18H13ClF3NO3 |
| Molecular Weight | 383.75 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 1-(4-chlorophenyl)cyclopropane-1-carboxylate |
| SMILES | O=C(COC(=O)C1(c2ccc(Cl)cc2)CC1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H13ClF3NO3/c19-11-3-1-10(2-4-11)18(7-8-18)17(25)26-9-14(24)23-13-6-5-12(20)15(21)16(13)22/h1-6H,7-9H2,(H,23,24) |
| InChIKey | UUFWEEOJMHKIQR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.75 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|