C15H14ClNO3 — CID 8642302
[2-oxo-2-(prop-2-ynylamino)ethyl] 1-(4-chlorophenyl)cyclopropane-1-carboxylate (PubChem CID 8642302) has the molecular formula C15H14ClNO3 and a molecular weight of 291.73 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-ynylamino)ethyl] 1-(4-chlorophenyl)cyclopropane-1-carboxylate.
| Compound Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 1-(4-chlorophenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 8642302 |
| Molecular Formula | C15H14ClNO3 |
| Molecular Weight | 291.73 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 1-(4-chlorophenyl)cyclopropane-1-carboxylate |
| SMILES | C#CCNC(=O)COC(=O)C1(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C15H14ClNO3/c1-2-9-17-13(18)10-20-14(19)15(7-8-15)11-3-5-12(16)6-4-11/h1,3-6H,7-10H2,(H,17,18) |
| InChIKey | QWRZIHNLNDHOOM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.73 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|