C16H19ClN2O4 — CID 2566951
[2-(methylcarbamoylamino)-2-oxoethyl] 1-(4-chlorophenyl)cyclopentane-1-carboxylate (PubChem CID 2566951) has the molecular formula C16H19ClN2O4 and a molecular weight of 338.79 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxoethyl] 1-(4-chlorophenyl)cyclopentane-1-carboxylate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxoethyl] 1-(4-chlorophenyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 2566951 |
| Molecular Formula | C16H19ClN2O4 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxoethyl] 1-(4-chlorophenyl)cyclopentane-1-carboxylate |
| SMILES | CNC(=O)NC(=O)COC(=O)C1(c2ccc(Cl)cc2)CCCC1 |
| InChI | InChI=1S/C16H19ClN2O4/c1-18-15(22)19-13(20)10-23-14(21)16(8-2-3-9-16)11-4-6-12(17)7-5-11/h4-7H,2-3,8-10H2,1H3,(H2,18,19,20,22) |
| InChIKey | HSDKGIQYWOAYAJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |