C21H20ClNO5 — CID 8589552
methyl 4-[[[2-[1-(4-chlorophenyl)cyclopropanecarbonyl]oxyacetyl]amino]methyl]benzoate (PubChem CID 8589552) has the molecular formula C21H20ClNO5 and a molecular weight of 401.85 g/mol. Its IUPAC name is methyl 4-[[[2-[1-(4-chlorophenyl)cyclopropanecarbonyl]oxyacetyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[2-[1-(4-chlorophenyl)cyclopropanecarbonyl]oxyacetyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 8589552 |
| Molecular Formula | C21H20ClNO5 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | methyl 4-[[[2-[1-(4-chlorophenyl)cyclopropanecarbonyl]oxyacetyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)COC(=O)C2(c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H20ClNO5/c1-27-19(25)15-4-2-14(3-5-15)12-23-18(24)13-28-20(26)21(10-11-21)16-6-8-17(22)9-7-16/h2-9H,10-13H2,1H3,(H,23,24) |
| InChIKey | ATFAIZVRVFBUGG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |