C21H22ClNO3 — CID 8589533
[2-oxo-2-(2-propan-2-ylanilino)ethyl] 1-(4-chlorophenyl)cyclopropane-1-carboxylate (PubChem CID 8589533) has the molecular formula C21H22ClNO3 and a molecular weight of 371.86 g/mol. Its IUPAC name is [2-oxo-2-(2-propan-2-ylanilino)ethyl] 1-(4-chlorophenyl)cyclopropane-1-carboxylate.
| Compound Name | [2-oxo-2-(2-propan-2-ylanilino)ethyl] 1-(4-chlorophenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 8589533 |
| Molecular Formula | C21H22ClNO3 |
| Molecular Weight | 371.86 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | [2-oxo-2-(2-propan-2-ylanilino)ethyl] 1-(4-chlorophenyl)cyclopropane-1-carboxylate |
| SMILES | CC(C)c1ccccc1NC(=O)COC(=O)C1(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H22ClNO3/c1-14(2)17-5-3-4-6-18(17)23-19(24)13-26-20(25)21(11-12-21)15-7-9-16(22)10-8-15/h3-10,14H,11-13H2,1-2H3,(H,23,24) |
| InChIKey | VYBQTLLIUGWXGW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.86 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |