C13H10Cl2F3NO3 — CID 7864238
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 7864238) has the molecular formula C13H10Cl2F3NO3 and a molecular weight of 356.13 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 7864238 |
| Molecular Formula | C13H10Cl2F3NO3 |
| Molecular Weight | 356.13 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | C[C@]1(C(=O)OCC(=O)Nc2ccc(F)c(F)c2F)CC1(Cl)Cl |
| InChI | InChI=1S/C13H10Cl2F3NO3/c1-12(5-13(12,14)15)11(21)22-4-8(20)19-7-3-2-6(16)9(17)10(7)18/h2-3H,4-5H2,1H3,(H,19,20)/t12-/m1/s1 |
| InChIKey | JEYVNEVNDUSPTD-GFCCVEGCSA-N |
| XLogP | 3.17 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.13 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|