C14H14Cl2N2O4 — CID 4204868
[2-(2-carbamoylanilino)-2-oxoethyl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 4204868) has the molecular formula C14H14Cl2N2O4 and a molecular weight of 345.18 g/mol. Its IUPAC name is [2-(2-carbamoylanilino)-2-oxoethyl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | [2-(2-carbamoylanilino)-2-oxoethyl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 4204868 |
| Molecular Formula | C14H14Cl2N2O4 |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | [2-(2-carbamoylanilino)-2-oxoethyl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | CC1(C(=O)OCC(=O)Nc2ccccc2C(N)=O)CC1(Cl)Cl |
| InChI | InChI=1S/C14H14Cl2N2O4/c1-13(7-14(13,15)16)12(21)22-6-10(19)18-9-5-3-2-4-8(9)11(17)20/h2-5H,6-7H2,1H3,(H2,17,20)(H,18,19) |
| InChIKey | CNZUIGWAUKIVBO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|