C22H22Cl2N2O4 — CID 40833872
[2-oxo-2-[2-[[(1S)-1-phenylethyl]carbamoyl]anilino]ethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 40833872) has the molecular formula C22H22Cl2N2O4 and a molecular weight of 449.33 g/mol. Its IUPAC name is [2-oxo-2-[2-[[(1S)-1-phenylethyl]carbamoyl]anilino]ethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | [2-oxo-2-[2-[[(1S)-1-phenylethyl]carbamoyl]anilino]ethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 40833872 |
| Molecular Formula | C22H22Cl2N2O4 |
| Molecular Weight | 449.33 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | [2-oxo-2-[2-[[(1S)-1-phenylethyl]carbamoyl]anilino]ethyl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | C[C@H](NC(=O)c1ccccc1NC(=O)COC(=O)[C@@]1(C)CC1(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C22H22Cl2N2O4/c1-14(15-8-4-3-5-9-15)25-19(28)16-10-6-7-11-17(16)26-18(27)12-30-20(29)21(2)13-22(21,23)24/h3-11,14H,12-13H2,1-2H3,(H,25,28)(H,26,27)/t14-,21+/m0/s1 |
| InChIKey | XJOYMUCAIMYOFB-LHSJRXKWSA-N |
| XLogP | 4.24 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|