C22H20N2O4S — CID 42900841
[2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] thiophene-2-carboxylate (PubChem CID 42900841) has the molecular formula C22H20N2O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is [2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] thiophene-2-carboxylate.
| Compound Name | [2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 42900841 |
| Molecular Formula | C22H20N2O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | [2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] thiophene-2-carboxylate |
| SMILES | CC(NC(=O)c1ccccc1NC(=O)COC(=O)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C22H20N2O4S/c1-15(16-8-3-2-4-9-16)23-21(26)17-10-5-6-11-18(17)24-20(25)14-28-22(27)19-12-7-13-29-19/h2-13,15H,14H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | REMUFHMWSRLCJP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |