C24H28N2O5 — CID 46696756
[2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 1-hydroxycyclohexane-1-carboxylate (PubChem CID 46696756) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is [2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 1-hydroxycyclohexane-1-carboxylate.
| Compound Name | [2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 1-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 46696756 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | [2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 1-hydroxycyclohexane-1-carboxylate |
| SMILES | CC(NC(=O)c1ccccc1NC(=O)COC(=O)C1(O)CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C24H28N2O5/c1-17(18-10-4-2-5-11-18)25-22(28)19-12-6-7-13-20(19)26-21(27)16-31-23(29)24(30)14-8-3-9-15-24/h2,4-7,10-13,17,30H,3,8-9,14-16H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | SDVUEEBGGUZPAP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |