C24H26N2O4 — CID 7932422
[2-oxo-2-[2-[[(1S)-1-phenylethyl]carbamoyl]anilino]ethyl] (1S)-cyclohex-3-ene-1-carboxylate (PubChem CID 7932422) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is [2-oxo-2-[2-[[(1S)-1-phenylethyl]carbamoyl]anilino]ethyl] (1S)-cyclohex-3-ene-1-carboxylate.
| Compound Name | [2-oxo-2-[2-[[(1S)-1-phenylethyl]carbamoyl]anilino]ethyl] (1S)-cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 7932422 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | [2-oxo-2-[2-[[(1S)-1-phenylethyl]carbamoyl]anilino]ethyl] (1S)-cyclohex-3-ene-1-carboxylate |
| SMILES | C[C@H](NC(=O)c1ccccc1NC(=O)COC(=O)[C@@H]1CC=CCC1)c1ccccc1 |
| InChI | InChI=1S/C24H26N2O4/c1-17(18-10-4-2-5-11-18)25-23(28)20-14-8-9-15-21(20)26-22(27)16-30-24(29)19-12-6-3-7-13-19/h2-6,8-11,14-15,17,19H,7,12-13,16H2,1H3,(H,25,28)(H,26,27)/t17-,19+/m0/s1 |
| InChIKey | VVJKYZFYXWYTQD-PKOBYXMFSA-N |
| XLogP | 4.02 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|