C24H22N2O5 — CID 7866708
[2-oxo-2-[2-[[(1S)-1-phenylethyl]carbamoyl]anilino]ethyl] 4-hydroxybenzoate (PubChem CID 7866708) has the molecular formula C24H22N2O5 and a molecular weight of 418.45 g/mol. Its IUPAC name is [2-oxo-2-[2-[[(1S)-1-phenylethyl]carbamoyl]anilino]ethyl] 4-hydroxybenzoate.
| Compound Name | [2-oxo-2-[2-[[(1S)-1-phenylethyl]carbamoyl]anilino]ethyl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 7866708 |
| Molecular Formula | C24H22N2O5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | [2-oxo-2-[2-[[(1S)-1-phenylethyl]carbamoyl]anilino]ethyl] 4-hydroxybenzoate |
| SMILES | C[C@H](NC(=O)c1ccccc1NC(=O)COC(=O)c1ccc(O)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H22N2O5/c1-16(17-7-3-2-4-8-17)25-23(29)20-9-5-6-10-21(20)26-22(28)15-31-24(30)18-11-13-19(27)14-12-18/h2-14,16,27H,15H2,1H3,(H,25,29)(H,26,28)/t16-/m0/s1 |
| InChIKey | YHYGDEXXGGPAAT-INIZCTEOSA-N |
| XLogP | 3.68 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |