C28H28N2O5 — CID 55306100
[2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 4-(4-methylphenyl)-4-oxobutanoate (PubChem CID 55306100) has the molecular formula C28H28N2O5 and a molecular weight of 472.54 g/mol. Its IUPAC name is [2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 4-(4-methylphenyl)-4-oxobutanoate.
| Compound Name | [2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 4-(4-methylphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 55306100 |
| Molecular Formula | C28H28N2O5 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | [2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 4-(4-methylphenyl)-4-oxobutanoate |
| SMILES | Cc1ccc(C(=O)CCC(=O)OCC(=O)Nc2ccccc2C(=O)NC(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H28N2O5/c1-19-12-14-22(15-13-19)25(31)16-17-27(33)35-18-26(32)30-24-11-7-6-10-23(24)28(34)29-20(2)21-8-4-3-5-9-21/h3-15,20H,16-18H2,1-2H3,(H,29,34)(H,30,32) |
| InChIKey | RWUMKPRZOGOVOB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |