C26H27N3O5S — CID 46816846
[2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 4-(thiophene-3-carbonylamino)butanoate (PubChem CID 46816846) has the molecular formula C26H27N3O5S and a molecular weight of 493.59 g/mol. Its IUPAC name is [2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 4-(thiophene-3-carbonylamino)butanoate.
| Compound Name | [2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 4-(thiophene-3-carbonylamino)butanoate |
|---|---|
| PubChem CID | 46816846 |
| Molecular Formula | C26H27N3O5S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | [2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 4-(thiophene-3-carbonylamino)butanoate |
| SMILES | CC(NC(=O)c1ccccc1NC(=O)COC(=O)CCCNC(=O)c1ccsc1)c1ccccc1 |
| InChI | InChI=1S/C26H27N3O5S/c1-18(19-8-3-2-4-9-19)28-26(33)21-10-5-6-11-22(21)29-23(30)16-34-24(31)12-7-14-27-25(32)20-13-15-35-17-20/h2-6,8-11,13,15,17-18H,7,12,14,16H2,1H3,(H,27,32)(H,28,33)(H,29,30) |
| InChIKey | KCKADDINQVRZAP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|