C23H21N3O5 — CID 8792122
[2-oxo-2-[2-[[(1R)-1-phenylethyl]carbamoyl]anilino]ethyl] 1-oxidopyridin-1-ium-4-carboxylate (PubChem CID 8792122) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is [2-oxo-2-[2-[[(1R)-1-phenylethyl]carbamoyl]anilino]ethyl] 1-oxidopyridin-1-ium-4-carboxylate.
| Compound Name | [2-oxo-2-[2-[[(1R)-1-phenylethyl]carbamoyl]anilino]ethyl] 1-oxidopyridin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 8792122 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | [2-oxo-2-[2-[[(1R)-1-phenylethyl]carbamoyl]anilino]ethyl] 1-oxidopyridin-1-ium-4-carboxylate |
| SMILES | C[C@@H](NC(=O)c1ccccc1NC(=O)COC(=O)c1cc[n+]([O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C23H21N3O5/c1-16(17-7-3-2-4-8-17)24-22(28)19-9-5-6-10-20(19)25-21(27)15-31-23(29)18-11-13-26(30)14-12-18/h2-14,16H,15H2,1H3,(H,24,28)(H,25,27)/t16-/m1/s1 |
| InChIKey | QIDNRLNGCJBOKD-MRXNPFEDSA-N |
| XLogP | 2.61 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|