C25H23FN2O5 — CID 55316488
[2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 2-(2-fluorophenoxy)acetate (PubChem CID 55316488) has the molecular formula C25H23FN2O5 and a molecular weight of 450.47 g/mol. Its IUPAC name is [2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 2-(2-fluorophenoxy)acetate.
| Compound Name | [2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 2-(2-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 55316488 |
| Molecular Formula | C25H23FN2O5 |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | [2-oxo-2-[2-(1-phenylethylcarbamoyl)anilino]ethyl] 2-(2-fluorophenoxy)acetate |
| SMILES | CC(NC(=O)c1ccccc1NC(=O)COC(=O)COc1ccccc1F)c1ccccc1 |
| InChI | InChI=1S/C25H23FN2O5/c1-17(18-9-3-2-4-10-18)27-25(31)19-11-5-7-13-21(19)28-23(29)15-33-24(30)16-32-22-14-8-6-12-20(22)26/h2-14,17H,15-16H2,1H3,(H,27,31)(H,28,29) |
| InChIKey | BCZROSAXRULZJP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |