C22H23FN2O5 — CID 7842017
[2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl] 2-(2-fluorophenoxy)acetate (PubChem CID 7842017) has the molecular formula C22H23FN2O5 and a molecular weight of 414.43 g/mol. Its IUPAC name is [2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl] 2-(2-fluorophenoxy)acetate.
| Compound Name | [2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl] 2-(2-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 7842017 |
| Molecular Formula | C22H23FN2O5 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | [2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl] 2-(2-fluorophenoxy)acetate |
| SMILES | O=C(COC(=O)COc1ccccc1F)Nc1ccccc1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C22H23FN2O5/c23-17-10-4-6-12-19(17)29-14-21(27)30-13-20(26)25-18-11-5-3-9-16(18)22(28)24-15-7-1-2-8-15/h3-6,9-12,15H,1-2,7-8,13-14H2,(H,24,28)(H,25,26) |
| InChIKey | OLWAUVKAGQYTPL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |