C20H20N2O5 — CID 40616539
[2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 2-phenoxyacetate (PubChem CID 40616539) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 2-phenoxyacetate.
| Compound Name | [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 2-phenoxyacetate |
|---|---|
| PubChem CID | 40616539 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 2-phenoxyacetate |
| SMILES | O=C(COC(=O)COc1ccccc1)Nc1ccccc1C(=O)NC1CC1 |
| InChI | InChI=1S/C20H20N2O5/c23-18(12-27-19(24)13-26-15-6-2-1-3-7-15)22-17-9-5-4-8-16(17)20(25)21-14-10-11-14/h1-9,14H,10-13H2,(H,21,25)(H,22,23) |
| InChIKey | QENQRCNTNNWWLW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |