C22H26N2O3 — CID 1226844
N-cyclohexyl-2-[[2-(4-methylphenoxy)acetyl]amino]benzamide (PubChem CID 1226844) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is N-cyclohexyl-2-[[2-(4-methylphenoxy)acetyl]amino]benzamide.
| Compound Name | N-cyclohexyl-2-[[2-(4-methylphenoxy)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 1226844 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | N-cyclohexyl-2-[[2-(4-methylphenoxy)acetyl]amino]benzamide |
| SMILES | Cc1ccc(OCC(=O)Nc2ccccc2C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C22H26N2O3/c1-16-11-13-18(14-12-16)27-15-21(25)24-20-10-6-5-9-19(20)22(26)23-17-7-3-2-4-8-17/h5-6,9-14,17H,2-4,7-8,15H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | BETSYXNPFBBDTF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |