C24H28N4O3 — CID 18144272
2-[[2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl]amino]-N-cyclopropylbenzamide (PubChem CID 18144272) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is 2-[[2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl]amino]-N-cyclopropylbenzamide.
| Compound Name | 2-[[2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl]amino]-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 18144272 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 2-[[2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl]amino]-N-cyclopropylbenzamide |
| SMILES | O=C(CNc1ccccc1C(=O)NC1CC1)Nc1ccccc1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C24H28N4O3/c29-22(15-25-20-11-5-3-9-18(20)23(30)27-17-13-14-17)28-21-12-6-4-10-19(21)24(31)26-16-7-1-2-8-16/h3-6,9-12,16-17,25H,1-2,7-8,13-15H2,(H,26,31)(H,27,30)(H,28,29) |
| InChIKey | GQHCBCGLNCNUFT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |