C24H29ClN4O3 — CID 55917777
4-chloro-2-[[2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl]amino]-N-propylbenzamide (PubChem CID 55917777) has the molecular formula C24H29ClN4O3 and a molecular weight of 456.97 g/mol. Its IUPAC name is 4-chloro-2-[[2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl]amino]-N-propylbenzamide.
| Compound Name | 4-chloro-2-[[2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl]amino]-N-propylbenzamide |
|---|---|
| PubChem CID | 55917777 |
| Molecular Formula | C24H29ClN4O3 |
| Molecular Weight | 456.97 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 4-chloro-2-[[2-[2-(cyclopentylcarbamoyl)anilino]-2-oxoethyl]amino]-N-propylbenzamide |
| SMILES | CCCNC(=O)c1ccc(Cl)cc1NCC(=O)Nc1ccccc1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C24H29ClN4O3/c1-2-13-26-23(31)19-12-11-16(25)14-21(19)27-15-22(30)29-20-10-6-5-9-18(20)24(32)28-17-7-3-4-8-17/h5-6,9-12,14,17,27H,2-4,7-8,13,15H2,1H3,(H,26,31)(H,28,32)(H,29,30) |
| InChIKey | KGNBJIWIKOVSLU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.97 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |