C22H24Cl2N2O2 — CID 100606317
N-cyclohexyl-2-[3-(2,4-dichlorophenyl)propanoylamino]benzamide (PubChem CID 100606317) has the molecular formula C22H24Cl2N2O2 and a molecular weight of 419.35 g/mol. Its IUPAC name is N-cyclohexyl-2-[3-(2,4-dichlorophenyl)propanoylamino]benzamide.
| Compound Name | N-cyclohexyl-2-[3-(2,4-dichlorophenyl)propanoylamino]benzamide |
|---|---|
| PubChem CID | 100606317 |
| Molecular Formula | C22H24Cl2N2O2 |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | N-cyclohexyl-2-[3-(2,4-dichlorophenyl)propanoylamino]benzamide |
| SMILES | O=C(CCc1ccc(Cl)cc1Cl)Nc1ccccc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C22H24Cl2N2O2/c23-16-12-10-15(19(24)14-16)11-13-21(27)26-20-9-5-4-8-18(20)22(28)25-17-6-2-1-3-7-17/h4-5,8-10,12,14,17H,1-3,6-7,11,13H2,(H,25,28)(H,26,27) |
| InChIKey | SWFCUEYEPAGFBY-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |